![[4-(2-Morpholin-4-yl-2-oxoethoxy)phenyl]amine (CAS: 76870-09-2) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0683226.png "[4-(2-Morpholin-4-yl-2-oxoethoxy)phenyl]amine chemical structure")
[4-(2-Morpholin-4-yl-2-oxoethoxy)phenyl]amine
Catalog No: FT-0683226
CAS No: 76870-09-2
- Chemical Name: [4-(2-Morpholin-4-yl-2-oxoethoxy)phenyl]amine
- Molecular Formula: C12H16N2O3
- Molecular Weight: 236.27
- InChI Key: WGXAEWROXXXTPJ-UHFFFAOYSA-N
- InChI: InChI=1S/C12H16N2O3/c13-10-1-3-11(4-2-10)17-9-12(15)14-5-7-16-8-6-14/h1-4H,5-9,13H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 236.26700 |
| Density: | 1.24g/cm3 |
| CAS: | 76870-09-2 |
| Bolling_Point: | 479.7ºC at 760 mmHg |
| Product_Name: | 2-(4-aminophenoxy)-1-morpholin-4-ylethanone |
| Melting_Point: | N/A |
| Flash_Point: | 243.9ºC |
| MF: | C12H16N2O3 |
| Density: | 1.24g/cm3 |
|---|---|
| LogP: | 1.02550 |
| Flash_Point: | 243.9ºC |
| Refractive_Index: | 1.579 |
| FW: | 236.26700 |
| PSA: | 64.79000 |
| MF: | C12H16N2O3 |
| Bolling_Point: | 479.7ºC at 760 mmHg |
| Exact_Mass: | 236.11600 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
